EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10Cl2N2O3 |
| Net Charge | 0 |
| Average Mass | 325.151 |
| Monoisotopic Mass | 324.00685 |
| SMILES | O=C(COC(=O)c1ccccn1)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H10Cl2N2O3/c15-9-4-3-6-10(13(9)16)18-12(19)8-21-14(20)11-5-1-2-7-17-11/h1-7H,8H2,(H,18,19) |
| InChIKey | AVYINTPRJGWUCL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-pyridinecarboxylic acid [2-(2,3-dichloroanilino)-2-oxoethyl] ester (CHEBI:109523) is a aromatic carboxylic acid (CHEBI:33859) |
| 2-pyridinecarboxylic acid [2-(2,3-dichloroanilino)-2-oxoethyl] ester (CHEBI:109523) is a pyridines (CHEBI:26421) |
| Manual Xrefs | Databases |
|---|---|
| LSM-20921 | LINCS |