EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15661 - (2E)-2-(methoxycarbonylmethyl)but-2-enedioic acid
| Formula | C7H8O6 |
| Net Charge | 0 |
| Average Mass | 188.135 |
| Monoisotopic Mass | 188.03209 |
| SMILES | COC(=O)C/C(=C\C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H8O6/c1-13-6(10)3-4(7(11)12)2-5(8)9/h2H,3H2,1H3,(H,8,9)(H,11,12)/b4-2+ |
| InChIKey | MRNZYUAGJLJQAM-DUXPYHPUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-2-(methoxycarbonylmethyl)but-2-enedioic acid (CHEBI:15661) has functional parent fumaric acid (CHEBI:18012) |
| (2E)-2-(methoxycarbonylmethyl)but-2-enedioic acid (CHEBI:15661) is a dicarboxylic acid (CHEBI:35692) |
| (2E)-2-(methoxycarbonylmethyl)but-2-enedioic acid (CHEBI:15661) is a fatty acid methyl ester (CHEBI:4986) |
| (2E)-2-(methoxycarbonylmethyl)but-2-enedioic acid (CHEBI:15661) is a methyl ester (CHEBI:25248) |
| (2E)-2-(methoxycarbonylmethyl)but-2-enedioic acid (CHEBI:15661) is conjugate acid of (2E)-2-(methoxycarbonylmethyl)but-2-enedioate(2−) (CHEBI:57469) |
| Incoming Relation(s) |
| (2E)-2-(methoxycarbonylmethyl)but-2-enedioate(2−) (CHEBI:57469) is conjugate base of (2E)-2-(methoxycarbonylmethyl)but-2-enedioic acid (CHEBI:15661) |
| IUPAC Name |
|---|
| (2E)-2-(2-methoxy-2-oxoethyl)but-2-enedioic acid |
| Synonym | Source |
|---|---|
| (E)-2-(Methoxycarbonylmethyl)butenedioate | KEGG COMPOUND |