EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19NO4 |
| Net Charge | 0 |
| Average Mass | 337.375 |
| Monoisotopic Mass | 337.13141 |
| SMILES | CCOC(=O)c1cccc(N2C(=O)C3C(C2=O)C2C=CC3C23CC3)c1 |
| InChI | InChI=1S/C20H19NO4/c1-2-25-19(24)11-4-3-5-12(10-11)21-17(22)15-13-6-7-14(16(15)18(21)23)20(13)8-9-20/h3-7,10,13-16H,2,8-9H2,1H3 |
| InChIKey | LTYOSFJRLOPDLJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-20819 (CHEBI:109421) is a amidobenzoic acid (CHEBI:48470) |
| Manual Xrefs | Databases |
|---|---|
| LSM-20819 | LINCS |