EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H29N3O4 |
| Net Charge | 0 |
| Average Mass | 435.524 |
| Monoisotopic Mass | 435.21581 |
| SMILES | CCCCN(CCCC)C(=O)c1ccccc1NC(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H29N3O4/c1-3-5-15-27(16-6-4-2)23(30)20-13-9-10-14-21(20)26-22(29)17-28-24(31)18-11-7-8-12-19(18)25(28)32/h7-14H,3-6,15-17H2,1-2H3,(H,26,29) |
| InChIKey | GJCCJDRRBVXLGE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-dibutyl-2-[[2-(1,3-dioxo-2-isoindolyl)-1-oxoethyl]amino]benzamide (CHEBI:109362) is a amidobenzoic acid (CHEBI:48470) |
| Manual Xrefs | Databases |
|---|---|
| LSM-20760 | LINCS |