EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17ClN2O3S |
| Net Charge | 0 |
| Average Mass | 352.843 |
| Monoisotopic Mass | 352.06484 |
| SMILES | CCOC(=O)C1C(C)=NC(=S)N(C(C)=O)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17ClN2O3S/c1-4-22-15(21)13-9(2)18-16(23)19(10(3)20)14(13)11-5-7-12(17)8-6-11/h5-8,13-14H,4H2,1-3H3 |
| InChIKey | XONILWCJQBNRTI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-20446 (CHEBI:109048) is a pyrimidinecarboxylic acid (CHEBI:78574) |
| Manual Xrefs | Databases |
|---|---|
| LSM-20446 | LINCS |