EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H7NO3 |
| Net Charge | 0 |
| Average Mass | 189.170 |
| Monoisotopic Mass | 189.04259 |
| SMILES | N#CC(=Cc1cccc(O)c1)C(=O)O |
| InChI | InChI=1S/C10H7NO3/c11-6-8(10(13)14)4-7-2-1-3-9(12)5-7/h1-5,12H,(H,13,14) |
| InChIKey | HPLNTJVXWMJLNJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-cyano-3-(3-hydroxyphenyl)-2-propenoic acid (CHEBI:108596) is a hydroxycinnamic acid (CHEBI:24689) |
| Manual Xrefs | Databases |
|---|---|
| LSM-19979 | LINCS |