EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26Cl2O |
| Net Charge | 0 |
| Average Mass | 365.344 |
| Monoisotopic Mass | 364.13607 |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(O)c(Cc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C21H26Cl2O/c1-20(2,3)13-21(4,5)16-7-9-19(24)15(11-16)10-14-6-8-17(22)12-18(14)23/h6-9,11-12,24H,10,13H2,1-5H3 |
| InChIKey | HQVZOORKDNCGCK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[(2,4-dichlorophenyl)methyl]-4-(2,4,4-trimethylpentan-2-yl)phenol (CHEBI:108581) has role antibacterial agent (CHEBI:33282) |
| 2-[(2,4-dichlorophenyl)methyl]-4-(2,4,4-trimethylpentan-2-yl)phenol (CHEBI:108581) is a diarylmethane (CHEBI:51614) |
| Synonyms | Source |
|---|---|
| clofoctol | ChEMBL |
| Clofoctol | ChEMBL |
| NSC-758389 | ChEMBL |
| octofene | DrugCentral |
| Citations |
|---|