EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18N5O10P |
| Net Charge | 0 |
| Average Mass | 483.330 |
| Monoisotopic Mass | 483.07913 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OC(=O)c2cccc(O)c2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H18N5O10P/c18-14-10-15(20-5-19-14)22(6-21-10)16-13(26)12(25)9(31-16)4-30-33(28,29)32-17(27)7-2-1-3-8(23)11(7)24/h1-3,5-6,9,12-13,16,23-26H,4H2,(H,28,29)(H2,18,19,20)/t9-,12-,13-,16-/m1/s1 |
| InChIKey | ULPVJDOMCRTJSN-RVXWVPLUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dihydroxybenzoyl 5'-adenylate (CHEBI:15572) has functional parent adenosine 5'-monophosphate (CHEBI:16027) |
| 2,3-dihydroxybenzoyl 5'-adenylate (CHEBI:15572) has role Escherichia coli metabolite (CHEBI:76971) |
| 2,3-dihydroxybenzoyl 5'-adenylate (CHEBI:15572) is a adenosine 5'-phosphate (CHEBI:37096) |
| 2,3-dihydroxybenzoyl 5'-adenylate (CHEBI:15572) is a purine ribonucleoside 5'-monophosphate (CHEBI:37021) |
| 2,3-dihydroxybenzoyl 5'-adenylate (CHEBI:15572) is conjugate acid of 2,3-dihydroxybenzoyl 5'-adenylate(1−) (CHEBI:57417) |
| Incoming Relation(s) |
| 2,3-dihydroxybenzoyl 5'-adenylate(1−) (CHEBI:57417) is conjugate base of 2,3-dihydroxybenzoyl 5'-adenylate (CHEBI:15572) |
| IUPAC Name |
|---|
| 2,3-dihydroxybenzoyl 5'-adenylate |
| Synonyms | Source |
|---|---|
| (2,3-Dihydroxybenzoyl)adenylate | KEGG COMPOUND |
| adenosine 5'-(2,3-dihydroxybenzoyl hydrogen phosphate) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C04030 | KEGG COMPOUND |