EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20N2O5 |
| Net Charge | 0 |
| Average Mass | 368.389 |
| Monoisotopic Mass | 368.13722 |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)c1ccc(NC(=O)C2CCCO2)cc1 |
| InChI | InChI=1S/C20H20N2O5/c23-19(22-15-7-8-16-18(12-15)27-11-10-26-16)13-3-5-14(6-4-13)21-20(24)17-2-1-9-25-17/h3-8,12,17H,1-2,9-11H2,(H,21,24)(H,22,23) |
| InChIKey | FAVDGTRESIFVDK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[4-[(2,3-dihydro-1,4-benzodioxin-6-ylamino)-oxomethyl]phenyl]-2-oxolanecarboxamide (CHEBI:108458) is a amidobenzoic acid (CHEBI:48470) |
| Manual Xrefs | Databases |
|---|---|
| LSM-19834 | LINCS |