EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23N3O3 |
| Net Charge | 0 |
| Average Mass | 329.400 |
| Monoisotopic Mass | 329.17394 |
| SMILES | CCOC(=O)c1nc2ccccc2c1NC(=O)CN1CCCCC1 |
| InChI | InChI=1S/C18H23N3O3/c1-2-24-18(23)17-16(13-8-4-5-9-14(13)19-17)20-15(22)12-21-10-6-3-7-11-21/h4-5,8-9,19H,2-3,6-7,10-12H2,1H3,(H,20,22) |
| InChIKey | CUMOULPJLKYRTG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[[1-oxo-2-(1-piperidinyl)ethyl]amino]-1H-indole-2-carboxylic acid ethyl ester (CHEBI:108415) is a indolyl carboxylic acid (CHEBI:46867) |
| Manual Xrefs | Databases |
|---|---|
| LSM-19791 | LINCS |