EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15ClN4O3S |
| Net Charge | 0 |
| Average Mass | 402.863 |
| Monoisotopic Mass | 402.05534 |
| SMILES | COc1cc(C=NNC(=O)c2ccncc2)ccc1OCc1cnc(Cl)s1 |
| InChI | InChI=1S/C18H15ClN4O3S/c1-25-16-8-12(9-22-23-17(24)13-4-6-20-7-5-13)2-3-15(16)26-11-14-10-21-18(19)27-14/h2-10H,11H2,1H3,(H,23,24) |
| InChIKey | RYXRSILKRUOMNX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[[4-[(2-chloro-5-thiazolyl)methoxy]-3-methoxyphenyl]methylideneamino]-4-pyridinecarboxamide (CHEBI:108330) is a aromatic carboxylic acid (CHEBI:33859) |
| N-[[4-[(2-chloro-5-thiazolyl)methoxy]-3-methoxyphenyl]methylideneamino]-4-pyridinecarboxamide (CHEBI:108330) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Manual Xrefs | Databases |
|---|---|
| LSM-19706 | LINCS |