EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H11FN2O |
| Net Charge | 0 |
| Average Mass | 242.253 |
| Monoisotopic Mass | 242.08554 |
| SMILES | O=C(NN=Cc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C14H11FN2O/c15-13-8-6-11(7-9-13)10-16-17-14(18)12-4-2-1-3-5-12/h1-10H,(H,17,18) |
| InChIKey | DQYNLPXKASWMSL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(4-fluorophenyl)methylideneamino]benzamide (CHEBI:108156) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-19533 | LINCS |