EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N2O5 |
| Net Charge | 0 |
| Average Mass | 316.313 |
| Monoisotopic Mass | 316.10592 |
| SMILES | COc1cc(NC(=O)Nc2ccccc2)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C16H16N2O5/c1-22-13-8-11(15(19)20)12(9-14(13)23-2)18-16(21)17-10-6-4-3-5-7-10/h3-9H,1-2H3,(H,19,20)(H2,17,18,21) |
| InChIKey | RXKADNGKBUOGSH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[[anilino(oxo)methyl]amino]-4,5-dimethoxybenzoic acid (CHEBI:107970) is a methoxybenzoic acid (CHEBI:25238) |
| Manual Xrefs | Databases |
|---|---|
| LSM-19347 | LINCS |