EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H31N3O4 |
| Net Charge | 0 |
| Average Mass | 413.518 |
| Monoisotopic Mass | 413.23146 |
| SMILES | CCOC(=O)C1CCN(c2c(NCCCN(CC)c3ccccc3)c(=O)c2=O)CC1 |
| InChI | InChI=1S/C23H31N3O4/c1-3-25(18-9-6-5-7-10-18)14-8-13-24-19-20(22(28)21(19)27)26-15-11-17(12-16-26)23(29)30-4-2/h5-7,9-10,17,24H,3-4,8,11-16H2,1-2H3 |
| InChIKey | HNRIKSOYAMYABL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[2-[3-(N-ethylanilino)propylamino]-3,4-dioxo-1-cyclobutenyl]-4-piperidinecarboxylic acid ethyl ester (CHEBI:107958) is a carboxylic acid (CHEBI:33575) |
| 1-[2-[3-(N-ethylanilino)propylamino]-3,4-dioxo-1-cyclobutenyl]-4-piperidinecarboxylic acid ethyl ester (CHEBI:107958) is a piperidines (CHEBI:26151) |
| Manual Xrefs | Databases |
|---|---|
| LSM-19335 | LINCS |