EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22ClN3O2 |
| Net Charge | 0 |
| Average Mass | 299.802 |
| Monoisotopic Mass | 299.14005 |
| SMILES | CCN(CC)CCNC(=O)c1cc(Cl)c(N)cc1OC |
| InChI | InChI=1S/C14H22ClN3O2/c1-4-18(5-2)7-6-17-14(19)10-8-11(15)12(16)9-13(10)20-3/h8-9H,4-7,16H2,1-3H3,(H,17,19) |
| InChIKey | TTWJBBZEZQICBI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metoclopramide (CHEBI:107736) has role antiemetic (CHEBI:50919) |
| metoclopramide (CHEBI:107736) has role dopaminergic antagonist (CHEBI:48561) |
| metoclopramide (CHEBI:107736) has role environmental contaminant (CHEBI:78298) |
| metoclopramide (CHEBI:107736) has role gastrointestinal drug (CHEBI:55324) |
| metoclopramide (CHEBI:107736) has role xenobiotic (CHEBI:35703) |
| metoclopramide (CHEBI:107736) is a benzamides (CHEBI:22702) |
| metoclopramide (CHEBI:107736) is a monochlorobenzenes (CHEBI:83403) |
| metoclopramide (CHEBI:107736) is a substituted aniline (CHEBI:48975) |
| metoclopramide (CHEBI:107736) is a tertiary amino compound (CHEBI:50996) |
| metoclopramide (CHEBI:107736) is conjugate base of metoclopramide(1+) (CHEBI:61170) |
| Incoming Relation(s) |
| metoclopramide(1+) (CHEBI:61170) is conjugate acid of metoclopramide (CHEBI:107736) |
| IUPAC Name |
|---|
| 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide |
| INNs | Source |
|---|---|
| metoclopramida | ChemIDplus |
| metoclopramide | ChemIDplus |
| metoclopramidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-methoxy-4-amino-5-chloro-N,N-(dimethylaminoethyl)benzamide | ChemIDplus |
| 2-methoxy-5-chloroprocainamide | ChemIDplus |
| 4-amino-5-chloro-2-methoxy-N-(β-diethylaminoethyl)benzamide | ChemIDplus |
| 4-amino-5-chloro-N-(2-(diethylamino)ethyl)-o-anisamide | ChemIDplus |
| 4-amino-5-chloro-N-(2-(diethylamino)ethyl)-2-methoxybenzamide | ChEMBL |
| Brand Names | Source |
|---|---|
| Elieten | DrugBank |
| Reliveran | DrugBank |