EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14N2O5S |
| Net Charge | 0 |
| Average Mass | 310.331 |
| Monoisotopic Mass | 310.06234 |
| SMILES | O=C(O)c1cnc2ccc(S(=O)(=O)N3CCOCC3)cc12 |
| InChI | InChI=1S/C13H14N2O5S/c16-13(17)11-8-14-12-2-1-9(7-10(11)12)21(18,19)15-3-5-20-6-4-15/h1-2,7-8,14H,3-6H2,(H,16,17) |
| InChIKey | GBSJAXQEEOQIFP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(4-morpholinylsulfonyl)-1H-indole-3-carboxylic acid (CHEBI:107728) is a indolyl carboxylic acid (CHEBI:46867) |
| Manual Xrefs | Databases |
|---|---|
| LSM-19106 | LINCS |