EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H6ClNO2 |
| Net Charge | 0 |
| Average Mass | 195.605 |
| Monoisotopic Mass | 195.00871 |
| SMILES | O=C(O)c1cc2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C9H6ClNO2/c10-6-1-2-7-5(3-6)4-8(11-7)9(12)13/h1-4,11H,(H,12,13) |
| InChIKey | FUQOTYRCMBZFOL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-chloro-1H-indole-2-carboxylic acid (CHEBI:107646) is a indolyl carboxylic acid (CHEBI:46867) |
| Manual Xrefs | Databases |
|---|---|
| LSM-19012 | LINCS |