EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13NO4S |
| Net Charge | 0 |
| Average Mass | 315.350 |
| Monoisotopic Mass | 315.05653 |
| SMILES | N#CC(=Cc1ccc(O)c(O)c1)C(=O)OCCc1cccs1 |
| InChI | InChI=1S/C16H13NO4S/c17-10-12(8-11-3-4-14(18)15(19)9-11)16(20)21-6-5-13-2-1-7-22-13/h1-4,7-9,18-19H,5-6H2 |
| InChIKey | KCGLTUBCAGZLHP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-cyano-3-(3,4-dihydroxyphenyl)-2-propenoic acid 2-thiophen-2-ylethyl ester (CHEBI:107645) is a hydroxycinnamic acid (CHEBI:24689) |
| Manual Xrefs | Databases |
|---|---|
| LSM-19011 | LINCS |