EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6O4 |
| Net Charge | 0 |
| Average Mass | 166.132 |
| Monoisotopic Mass | 166.02661 |
| SMILES | O=C(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C8H6O4/c9-8(10)5-1-2-6-7(3-5)12-4-11-6/h1-3H,4H2,(H,9,10) |
| InChIKey | VDVJGIYXDVPQLP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Begonia nantoensis (ncbitaxon:78253) | rhizome (BTO:0001181) | DOI (10.1248/cpb.52.345) | |
| Piper philippinum (IPNI:682741-1) | stem (BTO:0001300) | PubMed (17585974) | |
| Pseudolarix amabilis (ncbitaxon:3355) | bark (BTO:0001301) | PubMed (24820992) | Isolated from root bark. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.14.14.91 ( trans-cinnamate 4-monooxygenase) inhibitor Any EC 1.14.14.* (oxidoreductase acting on paired donors, incorporating of 1 atom of oxygen, with reduced flavin or flavoprotein as one donor) inhibitor that interferes with the action of trans-cinnamate 4-monooxygenase (EC 1.14.14.91). antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | vulnerary A drug used in treating and healing of wounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piperonylic acid (CHEBI:107644) has role antifungal agent (CHEBI:35718) |
| piperonylic acid (CHEBI:107644) has role EC 1.14.14.91 ( trans-cinnamate 4-monooxygenase) inhibitor (CHEBI:184380) |
| piperonylic acid (CHEBI:107644) has role plant metabolite (CHEBI:76924) |
| piperonylic acid (CHEBI:107644) has role vulnerary (CHEBI:73336) |
| piperonylic acid (CHEBI:107644) is a aromatic carboxylic acid (CHEBI:33859) |
| piperonylic acid (CHEBI:107644) is a benzodioxoles (CHEBI:38298) |
| piperonylic acid (CHEBI:107644) is a monocarboxylic acid (CHEBI:25384) |
| piperonylic acid (CHEBI:107644) is conjugate acid of piperonylate (CHEBI:180537) |
| Incoming Relation(s) |
| piperonylate (CHEBI:180537) is conjugate base of piperonylic acid (CHEBI:107644) |
| IUPAC Name |
|---|
| 1,3-benzodioxole-5-carboxylic acid |
| Synonyms | Source |
|---|---|
| 1,3-dioxaindane-5-carboxylic acid | ChEBI |
| 2H-1,3-benzodioxole-5-carboxylic acid | ChEBI |
| 3,4-dioxymethylenebenzoic acid | ChemIDplus |
| 3,4-methylenedioxybenzoic acid | HMDB |
| 3,4-(methylenedioxy)benzoic acid | ChEBI |
| 5-benzodioxolecarboxylic acid | ChemIDplus |
| Citations |
|---|