EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10O6 |
| Net Charge | 0 |
| Average Mass | 238.195 |
| Monoisotopic Mass | 238.04774 |
| SMILES | CC(=O)Oc1cccc(C(=O)O)c1OC(C)=O |
| InChI | InChI=1S/C11H10O6/c1-6(12)16-9-5-3-4-8(11(14)15)10(9)17-7(2)13/h3-5H,1-2H3,(H,14,15) |
| InChIKey | NYIZXMGNIUSNKL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Application: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-diacetyloxybenzoic acid (CHEBI:107635) has role analgesic (CHEBI:35480) |
| 2,3-diacetyloxybenzoic acid (CHEBI:107635) is a benzoic acids (CHEBI:22723) |
| 2,3-diacetyloxybenzoic acid (CHEBI:107635) is a carboxylic ester (CHEBI:33308) |
| 2,3-diacetyloxybenzoic acid (CHEBI:107635) is a salicylates (CHEBI:26596) |
| INN | Source |
|---|---|
| dipirocetilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| artromialgina | DrugCentral |
| dipyrocetyl | ChEMBL |
| Dipyrocetyl | ChEMBL |
| movirene | DrugCentral |
| NSC-758212 | ChEMBL |
| pyrocat | DrugCentral |
| Citations |
|---|