EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21NO4S |
| Net Charge | 0 |
| Average Mass | 335.425 |
| Monoisotopic Mass | 335.11913 |
| SMILES | CCOC(=O)c1cc(C)sc1N=CC1C(=O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C17H21NO4S/c1-5-22-16(21)11-6-10(2)23-15(11)18-9-12-13(19)7-17(3,4)8-14(12)20/h6,9,12H,5,7-8H2,1-4H3 |
| InChIKey | GHQPDFDSYXHBEW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]-5-methyl-3-thiophenecarboxylic acid ethyl ester (CHEBI:107364) is a thiophenecarboxylic acid (CHEBI:48436) |
| Manual Xrefs | Databases |
|---|---|
| LSM-18718 | LINCS |