EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17NO4 |
| Net Charge | 0 |
| Average Mass | 311.337 |
| Monoisotopic Mass | 311.11576 |
| SMILES | COc1ccccc1C=CC(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H17NO4/c1-21-15-5-3-2-4-13(15)6-9-18(20)19-14-7-8-16-17(12-14)23-11-10-22-16/h2-9,12H,10-11H2,1H3,(H,19,20) |
| InChIKey | MEOGKJOTLWVCRS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2-methoxyphenyl)-2-propenamide (CHEBI:107278) is a hydroxycinnamic acid (CHEBI:24689) |
| Manual Xrefs | Databases |
|---|---|
| LSM-18632 | LINCS |