EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24N2O3 |
| Net Charge | 0 |
| Average Mass | 340.423 |
| Monoisotopic Mass | 340.17869 |
| SMILES | Cc1cccc(OCCC(=O)NCC(=O)Nc2cccc(C)c2C)c1 |
| InChI | InChI=1S/C20H24N2O3/c1-14-6-4-8-17(12-14)25-11-10-19(23)21-13-20(24)22-18-9-5-7-15(2)16(18)3/h4-9,12H,10-11,13H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | VCGOOIJTDSWFGV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[2-(2,3-dimethylanilino)-2-oxoethyl]-3-(3-methylphenoxy)propanamide (CHEBI:107231) is a N-acyl-amino acid (CHEBI:51569) |
| Manual Xrefs | Databases |
|---|---|
| LSM-18585 | LINCS |