EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17NO5S |
| Net Charge | 0 |
| Average Mass | 335.381 |
| Monoisotopic Mass | 335.08274 |
| SMILES | COC(=O)c1cc(OC)c(OC)cc1NC(=O)Cc1cccs1 |
| InChI | InChI=1S/C16H17NO5S/c1-20-13-8-11(16(19)22-3)12(9-14(13)21-2)17-15(18)7-10-5-4-6-23-10/h4-6,8-9H,7H2,1-3H3,(H,17,18) |
| InChIKey | GWIRYOOQAMFEDV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5-dimethoxy-2-[(1-oxo-2-thiophen-2-ylethyl)amino]benzoic acid methyl ester (CHEBI:107214) is a amidobenzoic acid (CHEBI:48470) |
| Manual Xrefs | Databases |
|---|---|
| LSM-18568 | LINCS |