EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23NO4 |
| Net Charge | 0 |
| Average Mass | 341.407 |
| Monoisotopic Mass | 341.16271 |
| SMILES | CC1CC(C)CN(C(=O)COC(=O)c2cc3ccccc3cc2O)C1 |
| InChI | InChI=1S/C20H23NO4/c1-13-7-14(2)11-21(10-13)19(23)12-25-20(24)17-8-15-5-3-4-6-16(15)9-18(17)22/h3-6,8-9,13-14,22H,7,10-12H2,1-2H3 |
| InChIKey | MRZZJIANPBNXMB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-2-naphthalenecarboxylic acid [2-(3,5-dimethyl-1-piperidinyl)-2-oxoethyl] ester (CHEBI:107135) is a naphthoic acid (CHEBI:25483) |
| Manual Xrefs | Databases |
|---|---|
| LSM-18489 | LINCS |