EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18N2O4 |
| Net Charge | 0 |
| Average Mass | 374.396 |
| Monoisotopic Mass | 374.12666 |
| SMILES | C[C@@]1(c2ccc(Oc3ccccc3)cc2)OC(=O)N(Nc2ccccc2)C1=O |
| InChI | InChI=1S/C22H18N2O4/c1-22(16-12-14-19(15-13-16)27-18-10-6-3-7-11-18)20(25)24(21(26)28-22)23-17-8-4-2-5-9-17/h2-15,23H,1H3/t22-/m0/s1 |
| InChIKey | PCCSBWNGDMYFCW-QFIPXVFZSA-N |
| Roles Classification |
|---|
| Biological Roles: | fungicide A substance used to destroy fungal pests. quinone outside inhibitor A mitochondrial cytochrome-bc1 complex inhibitor that acts at the Quinone 'outer' (Qo) binding site of the cytochrome-bc1 complex. |
| Applications: | fungicide A substance used to destroy fungal pests. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. quinone outside inhibitor A mitochondrial cytochrome-bc1 complex inhibitor that acts at the Quinone 'outer' (Qo) binding site of the cytochrome-bc1 complex. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-famoxadone (CHEBI:106738) has role agrochemical (CHEBI:33286) |
| (S)-famoxadone (CHEBI:106738) has role fungicide (CHEBI:24127) |
| (S)-famoxadone (CHEBI:106738) has role mitochondrial cytochrome-bc1 complex inhibitor (CHEBI:38499) |
| (S)-famoxadone (CHEBI:106738) has role quinone outside inhibitor (CHEBI:141153) |
| (S)-famoxadone (CHEBI:106738) is a 5-methyl-5-(4-phenoxyphenyl)-3-(phenylamino)-1,3-oxazolidine-2,4-dione (CHEBI:83250) |
| (S)-famoxadone (CHEBI:106738) is enantiomer of (R)-famoxadone (CHEBI:83252) |
| Incoming Relation(s) |
| famoxadone (CHEBI:59340) has part (S)-famoxadone (CHEBI:106738) |
| (R)-famoxadone (CHEBI:83252) is enantiomer of (S)-famoxadone (CHEBI:106738) |
| IUPAC Name |
|---|
| (5S)-3-anilino-5-methyl-5-(4-phenoxyphenyl)-1,3-oxazolidine-2,4-dione |
| Synonyms | Source |
|---|---|
| (5S)-5-methyl-5-(4-phenoxyphenyl)-3-(phenylamino)-1,3-oxazolidine-2,4-dione | IUPAC |
| (−)-famoxadone | ChEBI |
| (S)-(−)-famoxadone | ChEBI |
| (S)-5-Methyl-5-(4-phenoxy-phenyl)-3-phenylamino-oxazolidine-2,4-dione | ChEMBL |
| Citations |
|---|