EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O5 |
| Net Charge | 0 |
| Average Mass | 212.201 |
| Monoisotopic Mass | 212.06847 |
| SMILES | CCCOC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C10H12O5/c1-2-3-15-10(14)6-4-7(11)9(13)8(12)5-6/h4-5,11-13H,2-3H2,1H3 |
| InChIKey | ZTHYODDOHIVTJV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| n-propyl gallate (CHEBI:10607) is a trihydroxybenzoic acid (CHEBI:27115) |
| Synonyms | Source |
|---|---|
| Anhydrous propyl gallate (e 310) | ChEMBL |
| E-310 | ChEMBL |
| E310 | ChEMBL |
| FEMA NO. 2947 | ChEMBL |
| Gallic acid, propyl ester | ChEMBL |
| INS-310 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| C11155 | KEGG COMPOUND |
| D02382 | KEGG DRUG |
| HMDB0033835 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:121-79-9 | KEGG COMPOUND |
| Citations |
|---|