EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18N2O2 |
| Net Charge | 0 |
| Average Mass | 342.398 |
| Monoisotopic Mass | 342.13683 |
| SMILES | O=C(c1ccccc1)N1N=C(c2ccccc2)CC1c1ccccc1O |
| InChI | InChI=1S/C22H18N2O2/c25-21-14-8-7-13-18(21)20-15-19(16-9-3-1-4-10-16)23-24(20)22(26)17-11-5-2-6-12-17/h1-14,20,25H,15H2 |
| InChIKey | FSRNJBKLLKZKNJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [3-(2-hydroxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-phenylmethanone (CHEBI:106062) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-17423 | LINCS |