EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10F2N2O2S |
| Net Charge | 0 |
| Average Mass | 272.276 |
| Monoisotopic Mass | 272.04311 |
| SMILES | O=C(NC1=NCCS1)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C11H10F2N2O2S/c12-10(13)17-8-3-1-2-7(6-8)9(16)15-11-14-4-5-18-11/h1-3,6,10H,4-5H2,(H,14,15,16) |
| InChIKey | SXIIWLMZXIGPJU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(difluoromethoxy)-N-(4,5-dihydrothiazol-2-yl)benzamide (CHEBI:106038) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-17399 | LINCS |