EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29N3O3 |
| Net Charge | 0 |
| Average Mass | 407.514 |
| Monoisotopic Mass | 407.22089 |
| SMILES | CCOC(=O)C1=C(CNCc2ccc(C)cc2)NC(=O)NC1c1cc(C)ccc1C |
| InChI | InChI=1S/C24H29N3O3/c1-5-30-23(28)21-20(14-25-13-18-10-7-15(2)8-11-18)26-24(29)27-22(21)19-12-16(3)6-9-17(19)4/h6-12,22,25H,5,13-14H2,1-4H3,(H2,26,27,29) |
| InChIKey | IIWDWNYHEGFJHI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(2,5-dimethylphenyl)-6-[[(4-methylphenyl)methylamino]methyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylic acid ethyl ester (CHEBI:105965) is a pyrimidinecarboxylic acid (CHEBI:78574) |
| Manual Xrefs | Databases |
|---|---|
| LSM-17326 | LINCS |