EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17N5O3S |
| Net Charge | 0 |
| Average Mass | 335.389 |
| Monoisotopic Mass | 335.10521 |
| SMILES | COc1ccc(C(=O)NNC(=O)CSc2nnc(C)n2C)cc1 |
| InChI | InChI=1S/C14H17N5O3S/c1-9-15-18-14(19(9)2)23-8-12(20)16-17-13(21)10-4-6-11(22-3)7-5-10/h4-7H,8H2,1-3H3,(H,16,20)(H,17,21) |
| InChIKey | YLTHTTDLKLECTK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N'-[2-[(4,5-dimethyl-1,2,4-triazol-3-yl)thio]-1-oxoethyl]-4-methoxybenzohydrazide (CHEBI:105958) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-17319 | LINCS |