EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13ClN2 |
| Net Charge | 0 |
| Average Mass | 196.681 |
| Monoisotopic Mass | 196.07673 |
| SMILES | Clc1cccc(N2CCNCC2)c1 |
| InChI | InChI=1S/C10H13ClN2/c11-9-2-1-3-10(8-9)13-6-4-12-5-7-13/h1-3,8,12H,4-7H2 |
| InChIKey | VHFVKMTVMIZMIK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| Application: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(3-chlorophenyl)piperazine (CHEBI:10588) has role drug metabolite (CHEBI:49103) |
| 1-(3-chlorophenyl)piperazine (CHEBI:10588) has role environmental contaminant (CHEBI:78298) |
| 1-(3-chlorophenyl)piperazine (CHEBI:10588) has role serotonergic agonist (CHEBI:35941) |
| 1-(3-chlorophenyl)piperazine (CHEBI:10588) has role xenobiotic (CHEBI:35703) |
| 1-(3-chlorophenyl)piperazine (CHEBI:10588) is a N-arylpiperazine (CHEBI:46848) |
| 1-(3-chlorophenyl)piperazine (CHEBI:10588) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| 1-(3-chlorophenyl)piperazine |
| Synonyms | Source |
|---|---|
| 1-(3-Chlorophenyl)piperazine | KEGG COMPOUND |
| 1-m-chlorophenyl piperazine metabolite | ChEMBL |
| chlorophenylpiperazine | ChEMBL |
| Chlorophenylpiperazine | ChEMBL |
| m-Chlorophenylpiperazine | KEGG COMPOUND |
| (m-CPP) | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C11738 | KEGG COMPOUND |
| HMDB0061008 | HMDB |
| LSM-25627 | LINCS |
| Meta-Chlorophenylpiperazine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8409 | Reaxys |
| CAS:6640-24-0 | KEGG COMPOUND |
| CAS:6640-24-0 | ChemIDplus |
| Citations |
|---|