EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N2O3S |
| Net Charge | 0 |
| Average Mass | 228.273 |
| Monoisotopic Mass | 228.05686 |
| SMILES | CCCCSc1nc(C(=O)O)cc(=O)n1 |
| InChI | InChI=1S/C9H12N2O3S/c1-2-3-4-15-9-10-6(8(13)14)5-7(12)11-9/h5H,2-4H2,1H3,(H,13,14)(H,10,11,12) |
| InChIKey | NUBJVMLEUWMEQU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(butylthio)-4-oxo-1H-pyrimidine-6-carboxylic acid (CHEBI:105827) is a pyrimidinecarboxylic acid (CHEBI:78574) |
| Manual Xrefs | Databases |
|---|---|
| LSM-17188 | LINCS |