EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18N2O3 |
| Net Charge | 0 |
| Average Mass | 298.342 |
| Monoisotopic Mass | 298.13174 |
| SMILES | COc1cccc(NC(=O)CNC(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C17H18N2O3/c1-12-6-8-13(9-7-12)17(21)18-11-16(20)19-14-4-3-5-15(10-14)22-2/h3-10H,11H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | XRJPKMPRLKPPJI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[2-(3-methoxyanilino)-2-oxoethyl]-4-methylbenzamide (CHEBI:105817) is a N-acylglycine (CHEBI:16180) |
| Manual Xrefs | Databases |
|---|---|
| LSM-17178 | LINCS |