EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | CC1=CCC(C(C)C)=CC1 |
| InChI | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,7-8H,5-6H2,1-3H3 |
| InChIKey | YKFLAYDHMOASIY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| faeces (UBERON:0001988) | PubMed (17314143) | ||
| saliva (UBERON:0001836) | PubMed (24421258) | ||
| urine (BTO:0001419) | PubMed (22284503) | ||
| Melaleuca alternifolia (ncbitaxon:164405) | leaf (BTO:0000713) | PubMed (16418522) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-terpinene (CHEBI:10577) has role antioxidant (CHEBI:22586) |
| γ-terpinene (CHEBI:10577) has role human xenobiotic metabolite (CHEBI:76967) |
| γ-terpinene (CHEBI:10577) has role plant metabolite (CHEBI:76924) |
| γ-terpinene (CHEBI:10577) has role volatile oil component (CHEBI:27311) |
| γ-terpinene (CHEBI:10577) is a cyclohexadiene (CHEBI:37613) |
| γ-terpinene (CHEBI:10577) is a monoterpene (CHEBI:35187) |
| Incoming Relation(s) |
| tea tree oil (CHEBI:83629) has part γ-terpinene (CHEBI:10577) |
| IUPAC Name |
|---|
| 1-methyl-4-(propan-2-yl)cyclohexa-1,4-diene |
| Synonyms | Source |
|---|---|
| 1,4-p-Menthadiene | HMDB |
| 1-Isopropyl-4-methyl-1,4-cyclohexadiene | HMDB |
| 1-Isopropyl-4-methylcyclohexa-1,4-diene | HMDB |
| 1-Methyl-4-(1-methylethyl)-1,4-cyclohexadiene | ChemIDplus |
| 1-methyl-4-propan-2-ylcyclohexa-1,4-diene | ChEBI |
| 4-Isopropyl-1-methyl-1,4-cyclohexadiene | ChemIDplus |
| UniProt Name | Source |
|---|---|
| γ-terpinene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 2013 | BPDB |
| C00003061 | KNApSAcK |
| C09900 | KEGG COMPOUND |
| CPD-8736 | MetaCyc |
| HMDB0005806 | HMDB |
| LMPR0102090027 | LIPID MAPS |
| Terpinene | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2038347 | Reaxys |
| CAS:99-85-4 | ChemIDplus |
| CAS:99-85-4 | KEGG COMPOUND |
| Citations |
|---|