EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5Cl5 |
| Net Charge | 0 |
| Average Mass | 254.371 |
| Monoisotopic Mass | 251.88339 |
| SMILES | ClC1=C[C@@H](Cl)[C@H](Cl)[C@H](Cl)[C@H]1Cl |
| InChI | InChI=1S/C6H5Cl5/c7-2-1-3(8)5(10)6(11)4(2)9/h1-2,4-6H/t2-,4+,5+,6+/m1/s1 |
| InChIKey | MQYAVRUCONBHOR-JSTMLOLSSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R,4S,5S,6R)-1,3,4,5,6-pentachlorocyclohexene (CHEBI:10576) is a chlorocyclohexene (CHEBI:23139) |
| (3R,4S,5S,6R)-1,3,4,5,6-pentachlorocyclohexene (CHEBI:10576) is enantiomer of (3S,4R,5R,6S)-1,3,4,5,6-pentachlorocyclohexene (CHEBI:142493) |
| Incoming Relation(s) |
| rac-γ-pentachlorocyclohexene (CHEBI:142492) has part (3R,4S,5S,6R)-1,3,4,5,6-pentachlorocyclohexene (CHEBI:10576) |
| (3S,4R,5R,6S)-1,3,4,5,6-pentachlorocyclohexene (CHEBI:142493) is enantiomer of (3R,4S,5S,6R)-1,3,4,5,6-pentachlorocyclohexene (CHEBI:10576) |
| IUPAC Name |
|---|
| (3R,4S,5S,6R)-1,3,4,5,6-pentachlorocyclohexene |
| Synonyms | Source |
|---|---|
| 3(R),4(S),5(S),6(R)-PCCH | ChEBI |
| (1,3R,4S,5S,6R)-pentachlorocyclohexene | ChEBI |
| 1,3(R),4(S),5(S),6(R)-PCCH | ChEBI |
| UniProt Name | Source |
|---|---|
| (3R,4S,5S,6R)-pentachlorocyclohexene | UniProt |
| Citations |
|---|