EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20N4O3S2 |
| Net Charge | 0 |
| Average Mass | 416.528 |
| Monoisotopic Mass | 416.09768 |
| SMILES | CCOC(=O)c1ccc(NC(=O)CSc2nnc(-c3cccs3)n2CC)cc1 |
| InChI | InChI=1S/C19H20N4O3S2/c1-3-23-17(15-6-5-11-27-15)21-22-19(23)28-12-16(24)20-14-9-7-13(8-10-14)18(25)26-4-2/h5-11H,3-4,12H2,1-2H3,(H,20,24) |
| InChIKey | SJHXRRPFDDTNPC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[[2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)thio]-1-oxoethyl]amino]benzoic acid ethyl ester (CHEBI:105740) is a amidobenzoic acid (CHEBI:48470) |
| Manual Xrefs | Databases |
|---|---|
| LSM-17102 | LINCS |