EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15NO4 |
| Net Charge | 0 |
| Average Mass | 297.310 |
| Monoisotopic Mass | 297.10011 |
| SMILES | COc1ccc(C=CC(=O)Nc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C17H15NO4/c1-22-13-9-6-12(7-10-13)8-11-16(19)18-15-5-3-2-4-14(15)17(20)21/h2-11H,1H3,(H,18,19)(H,20,21) |
| InChIKey | CKQMTXLABQTGQB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[[3-(4-methoxyphenyl)-1-oxoprop-2-enyl]amino]benzoic acid (CHEBI:105696) has functional parent anthranilic acid (CHEBI:30754) |
| 2-[[3-(4-methoxyphenyl)-1-oxoprop-2-enyl]amino]benzoic acid (CHEBI:105696) is a amidobenzoic acid (CHEBI:48470) |
| 2-[[3-(4-methoxyphenyl)-1-oxoprop-2-enyl]amino]benzoic acid (CHEBI:105696) is a cinnamamides (CHEBI:23247) |
| 2-[[3-(4-methoxyphenyl)-1-oxoprop-2-enyl]amino]benzoic acid (CHEBI:105696) is a secondary carboxamide (CHEBI:140325) |
| Manual Xrefs | Databases |
|---|---|
| LSM-17058 | LINCS |