EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H31ClN4O3 |
| Net Charge | 0 |
| Average Mass | 422.957 |
| Monoisotopic Mass | 422.20847 |
| SMILES | O=C(Nc1ccc(Cl)cc1)NC1(C(=O)NCCCN2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C21H31ClN4O3/c22-17-5-7-18(8-6-17)24-20(28)25-21(9-2-1-3-10-21)19(27)23-11-4-12-26-13-15-29-16-14-26/h5-8H,1-4,9-16H2,(H,23,27)(H2,24,25,28) |
| InChIKey | YBFYVJOHPDSLSS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[[(4-chloroanilino)-oxomethyl]amino]-N-[3-(4-morpholinyl)propyl]-1-cyclohexanecarboxamide (CHEBI:105581) is a N-acyl-amino acid (CHEBI:51569) |
| Manual Xrefs | Databases |
|---|---|
| LSM-16944 | LINCS |