EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO2 |
| Net Charge | 0 |
| Average Mass | 167.208 |
| Monoisotopic Mass | 167.09463 |
| SMILES | CNCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H13NO2/c1-10-5-4-7-2-3-8(11)9(12)6-7/h2-3,6,10-12H,4-5H2,1H3 |
| InChIKey | NGKZFDYBISXGGS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epinine (CHEBI:10554) is a catecholamine (CHEBI:33567) |
| epinine (CHEBI:10554) is conjugate base of epinine cation (CHEBI:231771) |
| Incoming Relation(s) |
| epinine cation (CHEBI:231771) is conjugate acid of epinine (CHEBI:10554) |
| Synonyms | Source |
|---|---|
| Deoxyepinephrine | KEGG COMPOUND |
| Epinine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C07453 | KEGG COMPOUND |
| HMDB0032020 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:501-15-5 | KEGG COMPOUND |