EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N4O4 |
| Net Charge | 0 |
| Average Mass | 372.425 |
| Monoisotopic Mass | 372.17976 |
| SMILES | CCOCCCNC(=O)C(NC(=O)c1cnccn1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H24N4O4/c1-3-27-12-4-9-22-19(25)17(14-5-7-15(26-2)8-6-14)23-18(24)16-13-20-10-11-21-16/h5-8,10-11,13,17H,3-4,9,12H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | ABRPDYUZUHZPQW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[2-(3-ethoxypropylamino)-1-(4-methoxyphenyl)-2-oxoethyl]-2-pyrazinecarboxamide (CHEBI:105532) is a N-acyl-amino acid (CHEBI:51569) |
| Manual Xrefs | Databases |
|---|---|
| LSM-16895 | LINCS |