EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21NO5 |
| Net Charge | 0 |
| Average Mass | 343.379 |
| Monoisotopic Mass | 343.14197 |
| SMILES | COc1ccc(CC(=O)NC(CC(=O)O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C19H21NO5/c1-24-15-7-3-13(4-8-15)11-18(21)20-17(12-19(22)23)14-5-9-16(25-2)10-6-14/h3-10,17H,11-12H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | UDGBSSTULRPTIY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(4-methoxyphenyl)-3-[[2-(4-methoxyphenyl)-1-oxoethyl]amino]propanoic acid (CHEBI:105529) is a alkaloid (CHEBI:22315) |
| Manual Xrefs | Databases |
|---|---|
| LSM-16892 | LINCS |