EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22O4 |
| Net Charge | 0 |
| Average Mass | 290.359 |
| Monoisotopic Mass | 290.15181 |
| SMILES | [H][C@@]12/C=C(\C)CC/C=C(\C)C[C@@H](OC(C)=O)[C@@]1([H])C(=C)C(=O)O2 |
| InChI | InChI=1S/C17H22O4/c1-10-6-5-7-11(2)9-15-16(12(3)17(19)21-15)14(8-10)20-13(4)18/h6,9,14-16H,3,5,7-8H2,1-2,4H3/b10-6+,11-9+/t14-,15-,16-/m1/s1 |
| InChIKey | UPNVKIZABMRHNR-PWCAFIOLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis cerana (ncbitaxon:7461) | - | MetaboLights (MTBLS379) | |
| Liriodendron chinense (ncbitaxon:3414) | - | Article (Acta Botanica Yunnanica 23(1): 115-120, 134) | |
| Liriodendron tulipifera (ncbitaxon:3415) | leaf (BTO:0000713) | PubMed (24705566) | |
| Paramichelia baillonii (ncbitaxon:86754) | - | Article (Acta Botanica Yunnanica 23(1): 115-120, 134) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epi-tulipinolide (CHEBI:10552) has role antineoplastic agent (CHEBI:35610) |
| epi-tulipinolide (CHEBI:10552) has role antioxidant (CHEBI:22586) |
| epi-tulipinolide (CHEBI:10552) has role plant metabolite (CHEBI:76924) |
| epi-tulipinolide (CHEBI:10552) is a acetate ester (CHEBI:47622) |
| epi-tulipinolide (CHEBI:10552) is a germacranolide (CHEBI:73011) |
| IUPAC Name |
|---|
| (3aR,4R,6E,10E,11aR)-6,10-dimethyl-3-methylidene-2-oxo-2,3,3a,4,5,8,9,11a-octahydrocyclodeca[b]furan-4-yl acetate |
| Synonyms | Source |
|---|---|
| epitulipinolide | ChEBI |
| Eupatolide acetate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1626294 | Reaxys |
| CAS:24164-13-4 | KEGG COMPOUND |
| CAS:24164-13-4 | ChemIDplus |
| Citations |
|---|