EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22N2O4S2 |
| Net Charge | 0 |
| Average Mass | 394.518 |
| Monoisotopic Mass | 394.10210 |
| SMILES | CCOC(=O)c1c(C2CC2)csc1NC(=O)CSCc1c(C)noc1C |
| InChI | InChI=1S/C18H22N2O4S2/c1-4-23-18(22)16-14(12-5-6-12)8-26-17(16)19-15(21)9-25-7-13-10(2)20-24-11(13)3/h8,12H,4-7,9H2,1-3H3,(H,19,21) |
| InChIKey | MHTRURIKBXQYST-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-cyclopropyl-2-[[2-[(3,5-dimethyl-4-isoxazolyl)methylthio]-1-oxoethyl]amino]-3-thiophenecarboxylic acid ethyl ester (CHEBI:105514) is a thiophenecarboxylic acid (CHEBI:48436) |
| Manual Xrefs | Databases |
|---|---|
| LSM-16877 | LINCS |