EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H26N2O5S |
| Net Charge | 0 |
| Average Mass | 490.581 |
| Monoisotopic Mass | 490.15624 |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc(N3C(=O)[C@@H]4[C@H](C3=O)[C@H]3C=C[C@@H]4C3)cc2)sc2c1CCCC2 |
| InChI | InChI=1S/C27H26N2O5S/c1-2-34-27(33)22-18-5-3-4-6-19(18)35-24(22)28-23(30)14-9-11-17(12-10-14)29-25(31)20-15-7-8-16(13-15)21(20)26(29)32/h7-12,15-16,20-21H,2-6,13H2,1H3,(H,28,30)/t15-,16+,20+,21- |
| InChIKey | FHWYVIJGQZWILE-IFCLKOLQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-16774 (CHEBI:105411) is a amidobenzoic acid (CHEBI:48470) |
| Manual Xrefs | Databases |
|---|---|
| LSM-16774 | LINCS |