EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21N3O2 |
| Net Charge | 0 |
| Average Mass | 311.385 |
| Monoisotopic Mass | 311.16338 |
| SMILES | COc1cccc(C(C)=NNC(=O)c2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C18H21N3O2/c1-13(15-6-5-7-17(12-15)23-4)19-20-18(22)14-8-10-16(11-9-14)21(2)3/h5-12H,1-4H3,(H,20,22) |
| InChIKey | IXUKFOUQLSPSBE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(dimethylamino)-N-[1-(3-methoxyphenyl)ethylideneamino]benzamide (CHEBI:105410) is a aminobenzoic acid (CHEBI:22495) |
| Manual Xrefs | Databases |
|---|---|
| LSM-16773 | LINCS |