EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H10Cl2N2O3 |
| Net Charge | 0 |
| Average Mass | 361.184 |
| Monoisotopic Mass | 360.00685 |
| SMILES | O=C(O)c1cc(Cl)c(Cl)cc1C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C17H10Cl2N2O3/c18-12-7-10(11(17(23)24)8-13(12)19)16(22)21-14-5-1-3-9-4-2-6-20-15(9)14/h1-8H,(H,21,22)(H,23,24) |
| InChIKey | RAEGRZPQCSGOGU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5-dichloro-2-[oxo-(8-quinolinylamino)methyl]benzoic acid (CHEBI:105362) is a chlorobenzoic acid (CHEBI:23134) |
| Manual Xrefs | Databases |
|---|---|
| LSM-16725 | LINCS |