EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H13ClN2O3S2 |
| Net Charge | 0 |
| Average Mass | 344.845 |
| Monoisotopic Mass | 344.00561 |
| SMILES | CCOC(=O)c1sc(=NC(=O)c2ccc(Cl)s2)n(C)c1C |
| InChI | InChI=1S/C13H13ClN2O3S2/c1-4-19-12(18)10-7(2)16(3)13(21-10)15-11(17)8-5-6-9(14)20-8/h5-6H,4H2,1-3H3 |
| InChIKey | SYMZLNUWBPNEIT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[(5-chloro-2-thiophenyl)-oxomethyl]imino-3,4-dimethyl-5-thiazolecarboxylic acid ethyl ester (CHEBI:105294) is a aromatic carboxylic acid (CHEBI:33859) |
| 2-[(5-chloro-2-thiophenyl)-oxomethyl]imino-3,4-dimethyl-5-thiazolecarboxylic acid ethyl ester (CHEBI:105294) is a thiazoles (CHEBI:48901) |
| Manual Xrefs | Databases |
|---|---|
| LSM-16657 | LINCS |