EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25N3O4 |
| Net Charge | 0 |
| Average Mass | 419.481 |
| Monoisotopic Mass | 419.18451 |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)Nc1ccccc1C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C24H25N3O4/c28-21(15-27-23(30)17-11-5-6-12-18(17)24(27)31)26-20-14-8-7-13-19(20)22(29)25-16-9-3-1-2-4-10-16/h5-8,11-14,16H,1-4,9-10,15H2,(H,25,29)(H,26,28) |
| InChIKey | DGJLQBLHBYYACA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-cycloheptyl-2-[[2-(1,3-dioxo-2-isoindolyl)-1-oxoethyl]amino]benzamide (CHEBI:105221) is a amidobenzoic acid (CHEBI:48470) |
| Manual Xrefs | Databases |
|---|---|
| LSM-16584 | LINCS |