EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20N2O6 |
| Net Charge | 0 |
| Average Mass | 360.366 |
| Monoisotopic Mass | 360.13214 |
| SMILES | COC(=O)c1cc(OC)c(OC)cc1NC(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C18H20N2O6/c1-23-14-8-6-5-7-12(14)19-18(22)20-13-10-16(25-3)15(24-2)9-11(13)17(21)26-4/h5-10H,1-4H3,(H2,19,20,22) |
| InChIKey | FIZBBKVRSXLCOB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5-dimethoxy-2-[[(2-methoxyanilino)-oxomethyl]amino]benzoic acid methyl ester (CHEBI:105108) is a methoxybenzoic acid (CHEBI:25238) |
| Manual Xrefs | Databases |
|---|---|
| LSM-16471 | LINCS |